(2-Hydroxypropyl)-Beta-Cyclodextrin (HPBCD), 99.5% min., 100 grams
C of A with material if needed. Good luck! I have larger quantities available. just ask. This is for laboratory and scientific use only! Item is NOT regulated by the DOT.
C of A with material if needed. Good luck! I have larger quantities available. just ask. This is for laboratory and scientific use only! Item is NOT regulated by the DOT.
Spec: 99%;. CAS No.: 128446-35-5;. Molecular weght: 1135+58X;.
Spec: 99%;. CAS No.: 128446-35-5;. Molecular weght: 1135+58X;.
Hydroxypropyl-beta-CyclodextrinOther name: HP-β -CD or (2-Hydroxypropyl)-Beta-Cyclodextrin 1. Appearance: Hydroxypropyl-beta-Cyclodextrin is white powder, sweet, insipid innocent and can be used in both medicine field and food field. 2. Molecular formula: C42H70-XO35(CH2CHOH-CH3)X; 3. Molecular weght: 1135+58X; 4. CAS No.: 128446-35-5; 5. Spec: 99%;